(+)-SODIUM L-ASCORBATE CRYSTAL& 100 G
Rp 2.557.000
Hotline (061) 6641391
3-Nitrophenylhydrazine (3-NPH) is a derivatizing reagent used for the derivatization of carboxyl- and carbonyl-containing metabolites. This compound is also used as a high-efficiency chemical isotope-labeling reagent. Additionally, 3-nitrophenylhydrazine undergoes a condensation reaction with substituted benzaldehydes resulting in the formation of a series of ten substituted (E)-1-benzylidene-2-(3-nitrophenyl) hydrazine compounds.
Assay
98%
form
powder
mp
210 °C (dec.) (lit.)
SMILES string
Cl.NNc1cccc(c1)[N+]([O-])=O
InChI
1S/C6H7N3O2.ClH/c7-8-5-2-1-3-6(4-5)9(10)11;/h1-4,8H,7H2;1H
InChI key
BKOYKMLGFFASBG-UHFFFAOYSA-N
Rp 2.557.000
Rp 1.798.000
Rp 13.572.000
Rp 1.253.000
Rp 706.000